About 5-[4-(bromomethyl)-2,6-dichlorophenoxy]-3-propan-2-yl-1H-indole
5-[4-(bromomethyl)-2,6-dichlorophenoxy]-3-propan-2-yl-1H-indole (PubChem CID 22669624) has the molecular formula C18H16BrCl2NO
and a molecular weight of 413.14 g/mol. Its IUPAC name is 5-[4-(bromomethyl)-2,6-dichlorophenoxy]-3-propan-2-yl-1H-indole.
Molecular Properties
| Compound Name | 5-[4-(bromomethyl)-2,6-dichlorophenoxy]-3-propan-2-yl-1H-indole |
| PubChem CID | 22669624 |
| Molecular Formula | C18H16BrCl2NO |
| Molecular Weight | 413.14 g/mol |
| Exact Mass | 410.98 |
| IUPAC Name | 5-[4-(bromomethyl)-2,6-dichlorophenoxy]-3-propan-2-yl-1H-indole |
| SMILES | CC(C)c1c[nH]c2ccc(Oc3c(Cl)cc(CBr)cc3Cl)cc12 |
| InChI | InChI=1S/C18H16BrCl2NO/c1-10(2)14-9-22-17-4-3-12(7-13(14)17)23-18-15(20)5-11(8-19)6-16(18)21/h3-7,9-10,22H,8H2,1-2H3 |
| InChIKey | SHSJKMPWXDEKRB-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.14 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-(bromomethyl)-2,6-dichlorophenoxy]-3-propan-2-yl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(bromomethyl)-2,6-dichlorophenoxy]-3-propan-2-yl-1H-indole?
The IUPAC name of 5-[4-(bromomethyl)-2,6-dichlorophenoxy]-3-propan-2-yl-1H-indole (CID 22669624) is 5-[4-(bromomethyl)-2,6-dichlorophenoxy]-3-propan-2-yl-1H-indole.
What is the SMILES notation for 5-[4-(bromomethyl)-2,6-dichlorophenoxy]-3-propan-2-yl-1H-indole?
The canonical SMILES for 5-[4-(bromomethyl)-2,6-dichlorophenoxy]-3-propan-2-yl-1H-indole is CC(C)c1c[nH]c2ccc(Oc3c(Cl)cc(CBr)cc3Cl)cc12.
What is the InChIKey of 5-[4-(bromomethyl)-2,6-dichlorophenoxy]-3-propan-2-yl-1H-indole?
The InChIKey is SHSJKMPWXDEKRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16BrCl2NO/c1-10(2)14-9-22-17-4-3-12(7-13(14)17)23-18-15(20)5-11(8-19)6-16(18)21/h3-7,9-10,22H,8H2,1-2H3.
What are the key properties of 5-[4-(bromomethyl)-2,6-dichlorophenoxy]-3-propan-2-yl-1H-indole?
5-[4-(bromomethyl)-2,6-dichlorophenoxy]-3-propan-2-yl-1H-indole has a molecular weight of 413.14 g/mol, XLogP of 7.29, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(bromomethyl)-2,6-dichlorophenoxy]-3-propan-2-yl-1H-indole is sourced from PubChem (CID 22669624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).