C22H29ClF3N5O — CID 2266992
(5S,7R)-3-chloro-N-[3-(diethylamino)propyl]-5-(4-methylphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 2266992) has the molecular formula C22H29ClF3N5O and a molecular weight of 471.96 g/mol. Its IUPAC name is (5S,7R)-3-chloro-N-[3-(diethylamino)propyl]-5-(4-methylphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | (5S,7R)-3-chloro-N-[3-(diethylamino)propyl]-5-(4-methylphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 2266992 |
| Molecular Formula | C22H29ClF3N5O |
| Molecular Weight | 471.96 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | (5S,7R)-3-chloro-N-[3-(diethylamino)propyl]-5-(4-methylphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)c1nn2c(c1Cl)N[C@H](c1ccc(C)cc1)C[C@@H]2C(F)(F)F |
| InChI | InChI=1S/C22H29ClF3N5O/c1-4-30(5-2)12-6-11-27-21(32)19-18(23)20-28-16(15-9-7-14(3)8-10-15)13-17(22(24,25)26)31(20)29-19/h7-10,16-17,28H,4-6,11-13H2,1-3H3,(H,27,32)/t16-,17+/m0/s1 |
| InChIKey | ZVVARXDCHRKJJZ-DLBZAZTESA-N |
| XLogP | 4.97 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.96 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|