C22H20O4 — CID 22670004
3,5-dimethoxy-4-(4-phenylmethoxyphenyl)benzaldehyde (PubChem CID 22670004) has the molecular formula C22H20O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is 3,5-dimethoxy-4-(4-phenylmethoxyphenyl)benzaldehyde.
| Compound Name | 3,5-dimethoxy-4-(4-phenylmethoxyphenyl)benzaldehyde |
|---|---|
| PubChem CID | 22670004 |
| Molecular Formula | C22H20O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 3,5-dimethoxy-4-(4-phenylmethoxyphenyl)benzaldehyde |
| SMILES | COc1cc(C=O)cc(OC)c1-c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H20O4/c1-24-20-12-17(14-23)13-21(25-2)22(20)18-8-10-19(11-9-18)26-15-16-6-4-3-5-7-16/h3-14H,15H2,1-2H3 |
| InChIKey | DEMXQHUBFOQDOF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|