C10H4F16O — CID 22670076
8-ethenoxy-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8-hexadecafluorooctane (PubChem CID 22670076) has the molecular formula C10H4F16O and a molecular weight of 444.11 g/mol. Its IUPAC name is 8-ethenoxy-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8-hexadecafluorooctane.
| Compound Name | 8-ethenoxy-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8-hexadecafluorooctane |
|---|---|
| PubChem CID | 22670076 |
| Molecular Formula | C10H4F16O |
| Molecular Weight | 444.11 g/mol |
| Exact Mass | 444.00 |
| IUPAC Name | 8-ethenoxy-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8-hexadecafluorooctane |
| SMILES | C=COC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H4F16O/c1-2-27-3(11)4(12,13)5(14,15)6(16,17)7(18,19)8(20,21)9(22,23)10(24,25)26/h2-3H,1H2 |
| InChIKey | ZOQBJBFQYNUWRW-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.11 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|