About S-[[2-(4-tert-butylphenyl)-1,3-dithiolan-4-yl]methyl] prop-2-enethioate
S-[[2-(4-tert-butylphenyl)-1,3-dithiolan-4-yl]methyl] prop-2-enethioate (PubChem CID 22670216) has the molecular formula C17H22OS3
and a molecular weight of 338.56 g/mol. Its IUPAC name is S-[[2-(4-tert-butylphenyl)-1,3-dithiolan-4-yl]methyl] prop-2-enethioate.
Molecular Properties
| Compound Name | S-[[2-(4-tert-butylphenyl)-1,3-dithiolan-4-yl]methyl] prop-2-enethioate |
| PubChem CID | 22670216 |
| Molecular Formula | C17H22OS3 |
| Molecular Weight | 338.56 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | S-[[2-(4-tert-butylphenyl)-1,3-dithiolan-4-yl]methyl] prop-2-enethioate |
| SMILES | C=CC(=O)SCC1CSC(c2ccc(C(C)(C)C)cc2)S1 |
| InChI | InChI=1S/C17H22OS3/c1-5-15(18)19-10-14-11-20-16(21-14)12-6-8-13(9-7-12)17(2,3)4/h5-9,14,16H,1,10-11H2,2-4H3 |
| InChIKey | WTWXTWPIZLQLON-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.56 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[[2-(4-tert-butylphenyl)-1,3-dithiolan-4-yl]methyl] prop-2-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[[2-(4-tert-butylphenyl)-1,3-dithiolan-4-yl]methyl] prop-2-enethioate?
The IUPAC name of S-[[2-(4-tert-butylphenyl)-1,3-dithiolan-4-yl]methyl] prop-2-enethioate (CID 22670216) is S-[[2-(4-tert-butylphenyl)-1,3-dithiolan-4-yl]methyl] prop-2-enethioate.
What is the SMILES notation for S-[[2-(4-tert-butylphenyl)-1,3-dithiolan-4-yl]methyl] prop-2-enethioate?
The canonical SMILES for S-[[2-(4-tert-butylphenyl)-1,3-dithiolan-4-yl]methyl] prop-2-enethioate is C=CC(=O)SCC1CSC(c2ccc(C(C)(C)C)cc2)S1.
What is the InChIKey of S-[[2-(4-tert-butylphenyl)-1,3-dithiolan-4-yl]methyl] prop-2-enethioate?
The InChIKey is WTWXTWPIZLQLON-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22OS3/c1-5-15(18)19-10-14-11-20-16(21-14)12-6-8-13(9-7-12)17(2,3)4/h5-9,14,16H,1,10-11H2,2-4H3.
What are the key properties of S-[[2-(4-tert-butylphenyl)-1,3-dithiolan-4-yl]methyl] prop-2-enethioate?
S-[[2-(4-tert-butylphenyl)-1,3-dithiolan-4-yl]methyl] prop-2-enethioate has a molecular weight of 338.56 g/mol, XLogP of 5.28, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-[[2-(4-tert-butylphenyl)-1,3-dithiolan-4-yl]methyl] prop-2-enethioate is sourced from PubChem (CID 22670216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).