C9H16F5NOS — CID 22671175
N-methyl-3-(4,4,5,5,5-pentafluoropentylsulfinyl)propan-1-amine (PubChem CID 22671175) has the molecular formula C9H16F5NOS and a molecular weight of 281.29 g/mol. Its IUPAC name is N-methyl-3-(4,4,5,5,5-pentafluoropentylsulfinyl)propan-1-amine.
| Compound Name | N-methyl-3-(4,4,5,5,5-pentafluoropentylsulfinyl)propan-1-amine |
|---|---|
| PubChem CID | 22671175 |
| Molecular Formula | C9H16F5NOS |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | N-methyl-3-(4,4,5,5,5-pentafluoropentylsulfinyl)propan-1-amine |
| SMILES | CNCCCS(=O)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H16F5NOS/c1-15-5-3-7-17(16)6-2-4-8(10,11)9(12,13)14/h15H,2-7H2,1H3 |
| InChIKey | JGCBPEIVXRMWML-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|