C18H29N5O+2 — CID 2267125
4-N-(4-butoxyphenyl)-3-aza-1,5-diazoniaspiro[5.5]undeca-1,4-diene-2,4-diamine (PubChem CID 2267125) has the molecular formula C18H29N5O+2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 4-N-(4-butoxyphenyl)-3-aza-1,5-diazoniaspiro[5.5]undeca-1,4-diene-2,4-diamine.
| Compound Name | 4-N-(4-butoxyphenyl)-3-aza-1,5-diazoniaspiro[5.5]undeca-1,4-diene-2,4-diamine |
|---|---|
| PubChem CID | 2267125 |
| Molecular Formula | C18H29N5O+2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.24 |
| IUPAC Name | 4-N-(4-butoxyphenyl)-3-aza-1,5-diazoniaspiro[5.5]undeca-1,4-diene-2,4-diamine |
| SMILES | CCCCOc1ccc(NC2=[NH+]C3(CCCCC3)[NH+]=C(N)N2)cc1 |
| InChI | InChI=1S/C18H27N5O/c1-2-3-13-24-15-9-7-14(8-10-15)20-17-21-16(19)22-18(23-17)11-5-4-6-12-18/h7-10H,2-6,11-13H2,1H3,(H4,19,20,21,22,23)/p+2 |
| InChIKey | XNMRIEZMIYTDHV-UHFFFAOYSA-P |
| XLogP | -0.63 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|