C32H28F3NO3S — CID 22671682
2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidine-1-carboxylic acid (PubChem CID 22671682) has the molecular formula C32H28F3NO3S and a molecular weight of 563.64 g/mol. Its IUPAC name is 2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidine-1-carboxylic acid.
| Compound Name | 2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 22671682 |
| Molecular Formula | C32H28F3NO3S |
| Molecular Weight | 563.64 g/mol |
| Exact Mass | 563.17 |
| IUPAC Name | 2-[(2,4,5-trifluorophenyl)methoxymethyl]-4-tritylsulfanylpyrrolidine-1-carboxylic acid |
| SMILES | O=C(O)N1CC(SC(c2ccccc2)(c2ccccc2)c2ccccc2)CC1COCc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C32H28F3NO3S/c33-28-18-30(35)29(34)16-22(28)20-39-21-26-17-27(19-36(26)31(37)38)40-32(23-10-4-1-5-11-23,24-12-6-2-7-13-24)25-14-8-3-9-15-25/h1-16,18,26-27H,17,19-21H2,(H,37,38) |
| InChIKey | BMPLBPFNCVVXSX-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.64 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|