C17H22F3NO2S — CID 22671761
3-methyl-1-[4-sulfanyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidin-1-yl]butan-1-one (PubChem CID 22671761) has the molecular formula C17H22F3NO2S and a molecular weight of 361.43 g/mol. Its IUPAC name is 3-methyl-1-[4-sulfanyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidin-1-yl]butan-1-one.
| Compound Name | 3-methyl-1-[4-sulfanyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 22671761 |
| Molecular Formula | C17H22F3NO2S |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 3-methyl-1-[4-sulfanyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidin-1-yl]butan-1-one |
| SMILES | CC(C)CC(=O)N1CC(S)CC1COCc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C17H22F3NO2S/c1-10(2)3-17(22)21-7-13(24)5-12(21)9-23-8-11-4-15(19)16(20)6-14(11)18/h4,6,10,12-13,24H,3,5,7-9H2,1-2H3 |
| InChIKey | LOMLBSKSTCEHIR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|