About 1-ethylcyclohexa-3,5-diene-1,3-diol
1-ethylcyclohexa-3,5-diene-1,3-diol (PubChem CID 22672483) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is 1-ethylcyclohexa-3,5-diene-1,3-diol.
Molecular Properties
| Compound Name | 1-ethylcyclohexa-3,5-diene-1,3-diol |
| PubChem CID | 22672483 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 1-ethylcyclohexa-3,5-diene-1,3-diol |
| SMILES | CCC1(O)C=CC=C(O)C1 |
| InChI | InChI=1S/C8H12O2/c1-2-8(10)5-3-4-7(9)6-8/h3-5,9-10H,2,6H2,1H3 |
| InChIKey | MRVNKFHOCJWEBM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethylcyclohexa-3,5-diene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylcyclohexa-3,5-diene-1,3-diol?
The IUPAC name of 1-ethylcyclohexa-3,5-diene-1,3-diol (CID 22672483) is 1-ethylcyclohexa-3,5-diene-1,3-diol.
What is the SMILES notation for 1-ethylcyclohexa-3,5-diene-1,3-diol?
The canonical SMILES for 1-ethylcyclohexa-3,5-diene-1,3-diol is CCC1(O)C=CC=C(O)C1.
What is the InChIKey of 1-ethylcyclohexa-3,5-diene-1,3-diol?
The InChIKey is MRVNKFHOCJWEBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O2/c1-2-8(10)5-3-4-7(9)6-8/h3-5,9-10H,2,6H2,1H3.
What are the key properties of 1-ethylcyclohexa-3,5-diene-1,3-diol?
1-ethylcyclohexa-3,5-diene-1,3-diol has a molecular weight of 140.18 g/mol, XLogP of 1.53, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylcyclohexa-3,5-diene-1,3-diol is sourced from PubChem (CID 22672483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).