About 2-[2-[[(2,3-dimethylimidazo[1,2-a]pyridin-8-yl)amino]methyl]-3-methylphenoxy]ethanol
2-[2-[[(2,3-dimethylimidazo[1,2-a]pyridin-8-yl)amino]methyl]-3-methylphenoxy]ethanol (PubChem CID 22672577) has the molecular formula C19H23N3O2
and a molecular weight of 325.41 g/mol. Its IUPAC name is 2-[2-[[(2,3-dimethylimidazo[1,2-a]pyridin-8-yl)amino]methyl]-3-methylphenoxy]ethanol.
Molecular Properties
| Compound Name | 2-[2-[[(2,3-dimethylimidazo[1,2-a]pyridin-8-yl)amino]methyl]-3-methylphenoxy]ethanol |
| PubChem CID | 22672577 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 2-[2-[[(2,3-dimethylimidazo[1,2-a]pyridin-8-yl)amino]methyl]-3-methylphenoxy]ethanol |
| SMILES | Cc1cccc(OCCO)c1CNc1cccn2c(C)c(C)nc12 |
| InChI | InChI=1S/C19H23N3O2/c1-13-6-4-8-18(24-11-10-23)16(13)12-20-17-7-5-9-22-15(3)14(2)21-19(17)22/h4-9,20,23H,10-12H2,1-3H3 |
| InChIKey | RMYCUDGFBQAEQK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 58.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-[[(2,3-dimethylimidazo[1,2-a]pyridin-8-yl)amino]methyl]-3-methylphenoxy]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[[(2,3-dimethylimidazo[1,2-a]pyridin-8-yl)amino]methyl]-3-methylphenoxy]ethanol?
The IUPAC name of 2-[2-[[(2,3-dimethylimidazo[1,2-a]pyridin-8-yl)amino]methyl]-3-methylphenoxy]ethanol (CID 22672577) is 2-[2-[[(2,3-dimethylimidazo[1,2-a]pyridin-8-yl)amino]methyl]-3-methylphenoxy]ethanol.
What is the SMILES notation for 2-[2-[[(2,3-dimethylimidazo[1,2-a]pyridin-8-yl)amino]methyl]-3-methylphenoxy]ethanol?
The canonical SMILES for 2-[2-[[(2,3-dimethylimidazo[1,2-a]pyridin-8-yl)amino]methyl]-3-methylphenoxy]ethanol is Cc1cccc(OCCO)c1CNc1cccn2c(C)c(C)nc12.
What is the InChIKey of 2-[2-[[(2,3-dimethylimidazo[1,2-a]pyridin-8-yl)amino]methyl]-3-methylphenoxy]ethanol?
The InChIKey is RMYCUDGFBQAEQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3O2/c1-13-6-4-8-18(24-11-10-23)16(13)12-20-17-7-5-9-22-15(3)14(2)21-19(17)22/h4-9,20,23H,10-12H2,1-3H3.
What are the key properties of 2-[2-[[(2,3-dimethylimidazo[1,2-a]pyridin-8-yl)amino]methyl]-3-methylphenoxy]ethanol?
2-[2-[[(2,3-dimethylimidazo[1,2-a]pyridin-8-yl)amino]methyl]-3-methylphenoxy]ethanol has a molecular weight of 325.41 g/mol, XLogP of 3.24, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[[(2,3-dimethylimidazo[1,2-a]pyridin-8-yl)amino]methyl]-3-methylphenoxy]ethanol is sourced from PubChem (CID 22672577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).