About [8-[(2-chloro-6-methylphenyl)methylamino]-2,6-dimethylimidazo[1,2-a]pyridin-3-yl]methanol
[8-[(2-chloro-6-methylphenyl)methylamino]-2,6-dimethylimidazo[1,2-a]pyridin-3-yl]methanol (PubChem CID 22672586) has the molecular formula C18H20ClN3O
and a molecular weight of 329.83 g/mol. Its IUPAC name is [8-[(2-chloro-6-methylphenyl)methylamino]-2,6-dimethylimidazo[1,2-a]pyridin-3-yl]methanol.
Molecular Properties
| Compound Name | [8-[(2-chloro-6-methylphenyl)methylamino]-2,6-dimethylimidazo[1,2-a]pyridin-3-yl]methanol |
| PubChem CID | 22672586 |
| Molecular Formula | C18H20ClN3O |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | [8-[(2-chloro-6-methylphenyl)methylamino]-2,6-dimethylimidazo[1,2-a]pyridin-3-yl]methanol |
| SMILES | Cc1cc(NCc2c(C)cccc2Cl)c2nc(C)c(CO)n2c1 |
| InChI | InChI=1S/C18H20ClN3O/c1-11-7-16(18-21-13(3)17(10-23)22(18)9-11)20-8-14-12(2)5-4-6-15(14)19/h4-7,9,20,23H,8,10H2,1-3H3 |
| InChIKey | KMRJHAFYORZBHX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [8-[(2-chloro-6-methylphenyl)methylamino]-2,6-dimethylimidazo[1,2-a]pyridin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [8-[(2-chloro-6-methylphenyl)methylamino]-2,6-dimethylimidazo[1,2-a]pyridin-3-yl]methanol?
The IUPAC name of [8-[(2-chloro-6-methylphenyl)methylamino]-2,6-dimethylimidazo[1,2-a]pyridin-3-yl]methanol (CID 22672586) is [8-[(2-chloro-6-methylphenyl)methylamino]-2,6-dimethylimidazo[1,2-a]pyridin-3-yl]methanol.
What is the SMILES notation for [8-[(2-chloro-6-methylphenyl)methylamino]-2,6-dimethylimidazo[1,2-a]pyridin-3-yl]methanol?
The canonical SMILES for [8-[(2-chloro-6-methylphenyl)methylamino]-2,6-dimethylimidazo[1,2-a]pyridin-3-yl]methanol is Cc1cc(NCc2c(C)cccc2Cl)c2nc(C)c(CO)n2c1.
What is the InChIKey of [8-[(2-chloro-6-methylphenyl)methylamino]-2,6-dimethylimidazo[1,2-a]pyridin-3-yl]methanol?
The InChIKey is KMRJHAFYORZBHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20ClN3O/c1-11-7-16(18-21-13(3)17(10-23)22(18)9-11)20-8-14-12(2)5-4-6-15(14)19/h4-7,9,20,23H,8,10H2,1-3H3.
What are the key properties of [8-[(2-chloro-6-methylphenyl)methylamino]-2,6-dimethylimidazo[1,2-a]pyridin-3-yl]methanol?
[8-[(2-chloro-6-methylphenyl)methylamino]-2,6-dimethylimidazo[1,2-a]pyridin-3-yl]methanol has a molecular weight of 329.83 g/mol, XLogP of 4.02, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [8-[(2-chloro-6-methylphenyl)methylamino]-2,6-dimethylimidazo[1,2-a]pyridin-3-yl]methanol is sourced from PubChem (CID 22672586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).