About acetamide;hydrate
acetamide;hydrate (PubChem CID 22673283) has the molecular formula C2H7NO2
and a molecular weight of 77.08 g/mol. Its IUPAC name is acetamide;hydrate.
Molecular Properties
| Compound Name | acetamide;hydrate |
| PubChem CID | 22673283 |
| Molecular Formula | C2H7NO2 |
| Molecular Weight | 77.08 g/mol |
| Exact Mass | 77.05 |
| IUPAC Name | acetamide;hydrate |
| SMILES | CC(N)=O.O |
| InChI | InChI=1S/C2H5NO.H2O/c1-2(3)4;/h1H3,(H2,3,4);1H2 |
| InChIKey | UATOFRZSCHRPBG-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 77.08 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze acetamide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;hydrate?
The IUPAC name of acetamide;hydrate (CID 22673283) is acetamide;hydrate.
What is the SMILES notation for acetamide;hydrate?
The canonical SMILES for acetamide;hydrate is CC(N)=O.O.
What is the InChIKey of acetamide;hydrate?
The InChIKey is UATOFRZSCHRPBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO.H2O/c1-2(3)4;/h1H3,(H2,3,4);1H2.
What are the key properties of acetamide;hydrate?
acetamide;hydrate has a molecular weight of 77.08 g/mol, XLogP of -1.33, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;hydrate is sourced from PubChem (CID 22673283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).