About 2-hydroxy-N',N',2-trimethylbutanediamide
2-hydroxy-N',N',2-trimethylbutanediamide (PubChem CID 22673426) has the molecular formula C7H14N2O3
and a molecular weight of 174.20 g/mol. Its IUPAC name is 2-hydroxy-N',N',2-trimethylbutanediamide.
Molecular Properties
| Compound Name | 2-hydroxy-N',N',2-trimethylbutanediamide |
| PubChem CID | 22673426 |
| Molecular Formula | C7H14N2O3 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 2-hydroxy-N',N',2-trimethylbutanediamide |
| SMILES | CN(C)C(=O)CC(C)(O)C(N)=O |
| InChI | InChI=1S/C7H14N2O3/c1-7(12,6(8)11)4-5(10)9(2)3/h12H,4H2,1-3H3,(H2,8,11) |
| InChIKey | QEZOYFRGJWKKAQ-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxy-N',N',2-trimethylbutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-N',N',2-trimethylbutanediamide?
The IUPAC name of 2-hydroxy-N',N',2-trimethylbutanediamide (CID 22673426) is 2-hydroxy-N',N',2-trimethylbutanediamide.
What is the SMILES notation for 2-hydroxy-N',N',2-trimethylbutanediamide?
The canonical SMILES for 2-hydroxy-N',N',2-trimethylbutanediamide is CN(C)C(=O)CC(C)(O)C(N)=O.
What is the InChIKey of 2-hydroxy-N',N',2-trimethylbutanediamide?
The InChIKey is QEZOYFRGJWKKAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O3/c1-7(12,6(8)11)4-5(10)9(2)3/h12H,4H2,1-3H3,(H2,8,11).
What are the key properties of 2-hydroxy-N',N',2-trimethylbutanediamide?
2-hydroxy-N',N',2-trimethylbutanediamide has a molecular weight of 174.20 g/mol, XLogP of -1.30, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-N',N',2-trimethylbutanediamide is sourced from PubChem (CID 22673426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).