C14H16NO8P — CID 22673574
[[6-[1,1-dihydroxy-2-(3-hydroxyphenyl)ethyl]-3-hydroxy-5-oxocyclohexa-1,3-dien-1-yl]amino]phosphonic acid (PubChem CID 22673574) has the molecular formula C14H16NO8P and a molecular weight of 357.26 g/mol. Its IUPAC name is [[6-[1,1-dihydroxy-2-(3-hydroxyphenyl)ethyl]-3-hydroxy-5-oxocyclohexa-1,3-dien-1-yl]amino]phosphonic acid.
| Compound Name | [[6-[1,1-dihydroxy-2-(3-hydroxyphenyl)ethyl]-3-hydroxy-5-oxocyclohexa-1,3-dien-1-yl]amino]phosphonic acid |
|---|---|
| PubChem CID | 22673574 |
| Molecular Formula | C14H16NO8P |
| Molecular Weight | 357.26 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | [[6-[1,1-dihydroxy-2-(3-hydroxyphenyl)ethyl]-3-hydroxy-5-oxocyclohexa-1,3-dien-1-yl]amino]phosphonic acid |
| SMILES | O=C1C=C(O)C=C(NP(=O)(O)O)C1C(O)(O)Cc1cccc(O)c1 |
| InChI | InChI=1S/C14H16NO8P/c16-9-3-1-2-8(4-9)7-14(19,20)13-11(15-24(21,22)23)5-10(17)6-12(13)18/h1-6,13,16-17,19-20H,7H2,(H3,15,21,22,23) |
| InChIKey | MTGDISZGZLHAPF-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 167.55 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.26 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|