About [3,5-dihydroxy-2-[1-hydroxy-2-(3-hydroxyphenyl)propyl]phenyl] dihydrogen phosphate
[3,5-dihydroxy-2-[1-hydroxy-2-(3-hydroxyphenyl)propyl]phenyl] dihydrogen phosphate (PubChem CID 22674028) has the molecular formula C15H17O8P
and a molecular weight of 356.27 g/mol. Its IUPAC name is [3,5-dihydroxy-2-[1-hydroxy-2-(3-hydroxyphenyl)propyl]phenyl] dihydrogen phosphate.
Molecular Properties
| Compound Name | [3,5-dihydroxy-2-[1-hydroxy-2-(3-hydroxyphenyl)propyl]phenyl] dihydrogen phosphate |
| PubChem CID | 22674028 |
| Molecular Formula | C15H17O8P |
| Molecular Weight | 356.27 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | [3,5-dihydroxy-2-[1-hydroxy-2-(3-hydroxyphenyl)propyl]phenyl] dihydrogen phosphate |
| SMILES | CC(c1cccc(O)c1)C(O)c1c(O)cc(O)cc1OP(=O)(O)O |
| InChI | InChI=1S/C15H17O8P/c1-8(9-3-2-4-10(16)5-9)15(19)14-12(18)6-11(17)7-13(14)23-24(20,21)22/h2-8,15-19H,1H3,(H2,20,21,22) |
| InChIKey | UMLHSMFACYNFAD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [3,5-dihydroxy-2-[1-hydroxy-2-(3-hydroxyphenyl)propyl]phenyl] dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-dihydroxy-2-[1-hydroxy-2-(3-hydroxyphenyl)propyl]phenyl] dihydrogen phosphate?
The IUPAC name of [3,5-dihydroxy-2-[1-hydroxy-2-(3-hydroxyphenyl)propyl]phenyl] dihydrogen phosphate (CID 22674028) is [3,5-dihydroxy-2-[1-hydroxy-2-(3-hydroxyphenyl)propyl]phenyl] dihydrogen phosphate.
What is the SMILES notation for [3,5-dihydroxy-2-[1-hydroxy-2-(3-hydroxyphenyl)propyl]phenyl] dihydrogen phosphate?
The canonical SMILES for [3,5-dihydroxy-2-[1-hydroxy-2-(3-hydroxyphenyl)propyl]phenyl] dihydrogen phosphate is CC(c1cccc(O)c1)C(O)c1c(O)cc(O)cc1OP(=O)(O)O.
What is the InChIKey of [3,5-dihydroxy-2-[1-hydroxy-2-(3-hydroxyphenyl)propyl]phenyl] dihydrogen phosphate?
The InChIKey is UMLHSMFACYNFAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17O8P/c1-8(9-3-2-4-10(16)5-9)15(19)14-12(18)6-11(17)7-13(14)23-24(20,21)22/h2-8,15-19H,1H3,(H2,20,21,22).
What are the key properties of [3,5-dihydroxy-2-[1-hydroxy-2-(3-hydroxyphenyl)propyl]phenyl] dihydrogen phosphate?
[3,5-dihydroxy-2-[1-hydroxy-2-(3-hydroxyphenyl)propyl]phenyl] dihydrogen phosphate has a molecular weight of 356.27 g/mol, XLogP of 2.11, 5 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-dihydroxy-2-[1-hydroxy-2-(3-hydroxyphenyl)propyl]phenyl] dihydrogen phosphate is sourced from PubChem (CID 22674028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).