C18H17Cl2N3S — CID 22674225
3-(2,6-dichlorophenyl)sulfanyl-5-piperazin-1-yl-1H-indole (PubChem CID 22674225) has the molecular formula C18H17Cl2N3S and a molecular weight of 378.33 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)sulfanyl-5-piperazin-1-yl-1H-indole.
| Compound Name | 3-(2,6-dichlorophenyl)sulfanyl-5-piperazin-1-yl-1H-indole |
|---|---|
| PubChem CID | 22674225 |
| Molecular Formula | C18H17Cl2N3S |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 3-(2,6-dichlorophenyl)sulfanyl-5-piperazin-1-yl-1H-indole |
| SMILES | Clc1cccc(Cl)c1Sc1c[nH]c2ccc(N3CCNCC3)cc12 |
| InChI | InChI=1S/C18H17Cl2N3S/c19-14-2-1-3-15(20)18(14)24-17-11-22-16-5-4-12(10-13(16)17)23-8-6-21-7-9-23/h1-5,10-11,21-22H,6-9H2 |
| InChIKey | HSPVOBXDNZVDRW-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |