C22H35N3O2Si — CID 22674230
4-[1-tri(propan-2-yl)silylindol-5-yl]piperazine-1-carboxylic acid (PubChem CID 22674230) has the molecular formula C22H35N3O2Si and a molecular weight of 401.63 g/mol. Its IUPAC name is 4-[1-tri(propan-2-yl)silylindol-5-yl]piperazine-1-carboxylic acid.
| Compound Name | 4-[1-tri(propan-2-yl)silylindol-5-yl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 22674230 |
| Molecular Formula | C22H35N3O2Si |
| Molecular Weight | 401.63 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | 4-[1-tri(propan-2-yl)silylindol-5-yl]piperazine-1-carboxylic acid |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)n1ccc2cc(N3CCN(C(=O)O)CC3)ccc21 |
| InChI | InChI=1S/C22H35N3O2Si/c1-16(2)28(17(3)4,18(5)6)25-10-9-19-15-20(7-8-21(19)25)23-11-13-24(14-12-23)22(26)27/h7-10,15-18H,11-14H2,1-6H3,(H,26,27) |
| InChIKey | WIIOVZNEJMMJFV-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.63 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|