About 4-fluorophenol;4-(4-fluorophenoxy)-2-pyridin-4-ylpyrimidine-5-carboxylic acid
4-fluorophenol;4-(4-fluorophenoxy)-2-pyridin-4-ylpyrimidine-5-carboxylic acid (PubChem CID 22674348) has the molecular formula C22H15F2N3O4
and a molecular weight of 423.38 g/mol. Its IUPAC name is 4-fluorophenol;4-(4-fluorophenoxy)-2-pyridin-4-ylpyrimidine-5-carboxylic acid.
Molecular Properties
| Compound Name | 4-fluorophenol;4-(4-fluorophenoxy)-2-pyridin-4-ylpyrimidine-5-carboxylic acid |
| PubChem CID | 22674348 |
| Molecular Formula | C22H15F2N3O4 |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 4-fluorophenol;4-(4-fluorophenoxy)-2-pyridin-4-ylpyrimidine-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(-c2ccncc2)nc1Oc1ccc(F)cc1.Oc1ccc(F)cc1 |
| InChI | InChI=1S/C16H10FN3O3.C6H5FO/c17-11-1-3-12(4-2-11)23-15-13(16(21)22)9-19-14(20-15)10-5-7-18-8-6-10;7-5-1-3-6(8)4-2-5/h1-9H,(H,21,22);1-4,8H |
| InChIKey | UKLISNPOMRIYOU-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 105.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-fluorophenol;4-(4-fluorophenoxy)-2-pyridin-4-ylpyrimidine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluorophenol;4-(4-fluorophenoxy)-2-pyridin-4-ylpyrimidine-5-carboxylic acid?
The IUPAC name of 4-fluorophenol;4-(4-fluorophenoxy)-2-pyridin-4-ylpyrimidine-5-carboxylic acid (CID 22674348) is 4-fluorophenol;4-(4-fluorophenoxy)-2-pyridin-4-ylpyrimidine-5-carboxylic acid.
What is the SMILES notation for 4-fluorophenol;4-(4-fluorophenoxy)-2-pyridin-4-ylpyrimidine-5-carboxylic acid?
The canonical SMILES for 4-fluorophenol;4-(4-fluorophenoxy)-2-pyridin-4-ylpyrimidine-5-carboxylic acid is O=C(O)c1cnc(-c2ccncc2)nc1Oc1ccc(F)cc1.Oc1ccc(F)cc1.
What is the InChIKey of 4-fluorophenol;4-(4-fluorophenoxy)-2-pyridin-4-ylpyrimidine-5-carboxylic acid?
The InChIKey is UKLISNPOMRIYOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10FN3O3.C6H5FO/c17-11-1-3-12(4-2-11)23-15-13(16(21)22)9-19-14(20-15)10-5-7-18-8-6-10;7-5-1-3-6(8)4-2-5/h1-9H,(H,21,22);1-4,8H.
What are the key properties of 4-fluorophenol;4-(4-fluorophenoxy)-2-pyridin-4-ylpyrimidine-5-carboxylic acid?
4-fluorophenol;4-(4-fluorophenoxy)-2-pyridin-4-ylpyrimidine-5-carboxylic acid has a molecular weight of 423.38 g/mol, XLogP of 4.70, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluorophenol;4-(4-fluorophenoxy)-2-pyridin-4-ylpyrimidine-5-carboxylic acid is sourced from PubChem (CID 22674348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).