C24H23FN6O — CID 22675213
4-[5-(4-fluorophenyl)-3-(oxolan-3-yl)triazol-4-yl]-N-(1-phenylethyl)pyrimidin-2-amine (PubChem CID 22675213) has the molecular formula C24H23FN6O and a molecular weight of 430.49 g/mol. Its IUPAC name is 4-[5-(4-fluorophenyl)-3-(oxolan-3-yl)triazol-4-yl]-N-(1-phenylethyl)pyrimidin-2-amine.
| Compound Name | 4-[5-(4-fluorophenyl)-3-(oxolan-3-yl)triazol-4-yl]-N-(1-phenylethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 22675213 |
| Molecular Formula | C24H23FN6O |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 4-[5-(4-fluorophenyl)-3-(oxolan-3-yl)triazol-4-yl]-N-(1-phenylethyl)pyrimidin-2-amine |
| SMILES | CC(Nc1nccc(-c2c(-c3ccc(F)cc3)nnn2C2CCOC2)n1)c1ccccc1 |
| InChI | InChI=1S/C24H23FN6O/c1-16(17-5-3-2-4-6-17)27-24-26-13-11-21(28-24)23-22(18-7-9-19(25)10-8-18)29-30-31(23)20-12-14-32-15-20/h2-11,13,16,20H,12,14-15H2,1H3,(H,26,27,28) |
| InChIKey | QDSIAZLNCPRJNX-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |