About 1-(oxolan-3-yl)triazole
1-(oxolan-3-yl)triazole (PubChem CID 22675224) has the molecular formula C6H9N3O
and a molecular weight of 139.16 g/mol. Its IUPAC name is 1-(oxolan-3-yl)triazole.
Molecular Properties
| Compound Name | 1-(oxolan-3-yl)triazole |
| PubChem CID | 22675224 |
| Molecular Formula | C6H9N3O |
| Molecular Weight | 139.16 g/mol |
| Exact Mass | 139.07 |
| IUPAC Name | 1-(oxolan-3-yl)triazole |
| SMILES | c1cn(C2CCOC2)nn1 |
| InChI | InChI=1S/C6H9N3O/c1-4-10-5-6(1)9-3-2-7-8-9/h2-3,6H,1,4-5H2 |
| InChIKey | JEGNDSWERCCBKK-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.16 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(oxolan-3-yl)triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(oxolan-3-yl)triazole?
The IUPAC name of 1-(oxolan-3-yl)triazole (CID 22675224) is 1-(oxolan-3-yl)triazole.
What is the SMILES notation for 1-(oxolan-3-yl)triazole?
The canonical SMILES for 1-(oxolan-3-yl)triazole is c1cn(C2CCOC2)nn1.
What is the InChIKey of 1-(oxolan-3-yl)triazole?
The InChIKey is JEGNDSWERCCBKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O/c1-4-10-5-6(1)9-3-2-7-8-9/h2-3,6H,1,4-5H2.
What are the key properties of 1-(oxolan-3-yl)triazole?
1-(oxolan-3-yl)triazole has a molecular weight of 139.16 g/mol, XLogP of 0.24, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(oxolan-3-yl)triazole is sourced from PubChem (CID 22675224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).