About 4-[2-[4-[(6-bromo-1,3-benzodioxol-5-yl)methyl]piperidin-1-yl]ethyl]-2-chlorobenzamide
4-[2-[4-[(6-bromo-1,3-benzodioxol-5-yl)methyl]piperidin-1-yl]ethyl]-2-chlorobenzamide (PubChem CID 22675372) has the molecular formula C22H24BrClN2O3
and a molecular weight of 479.80 g/mol. Its IUPAC name is 4-[2-[4-[(6-bromo-1,3-benzodioxol-5-yl)methyl]piperidin-1-yl]ethyl]-2-chlorobenzamide.
Molecular Properties
| Compound Name | 4-[2-[4-[(6-bromo-1,3-benzodioxol-5-yl)methyl]piperidin-1-yl]ethyl]-2-chlorobenzamide |
| PubChem CID | 22675372 |
| Molecular Formula | C22H24BrClN2O3 |
| Molecular Weight | 479.80 g/mol |
| Exact Mass | 478.07 |
| IUPAC Name | 4-[2-[4-[(6-bromo-1,3-benzodioxol-5-yl)methyl]piperidin-1-yl]ethyl]-2-chlorobenzamide |
| SMILES | NC(=O)c1ccc(CCN2CCC(Cc3cc4c(cc3Br)OCO4)CC2)cc1Cl |
| InChI | InChI=1S/C22H24BrClN2O3/c23-18-12-21-20(28-13-29-21)11-16(18)9-15-4-7-26(8-5-15)6-3-14-1-2-17(22(25)27)19(24)10-14/h1-2,10-12,15H,3-9,13H2,(H2,25,27) |
| InChIKey | FGDNVROSAQGSRX-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 479.80 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-[4-[(6-bromo-1,3-benzodioxol-5-yl)methyl]piperidin-1-yl]ethyl]-2-chlorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[4-[(6-bromo-1,3-benzodioxol-5-yl)methyl]piperidin-1-yl]ethyl]-2-chlorobenzamide?
The IUPAC name of 4-[2-[4-[(6-bromo-1,3-benzodioxol-5-yl)methyl]piperidin-1-yl]ethyl]-2-chlorobenzamide (CID 22675372) is 4-[2-[4-[(6-bromo-1,3-benzodioxol-5-yl)methyl]piperidin-1-yl]ethyl]-2-chlorobenzamide.
What is the SMILES notation for 4-[2-[4-[(6-bromo-1,3-benzodioxol-5-yl)methyl]piperidin-1-yl]ethyl]-2-chlorobenzamide?
The canonical SMILES for 4-[2-[4-[(6-bromo-1,3-benzodioxol-5-yl)methyl]piperidin-1-yl]ethyl]-2-chlorobenzamide is NC(=O)c1ccc(CCN2CCC(Cc3cc4c(cc3Br)OCO4)CC2)cc1Cl.
What is the InChIKey of 4-[2-[4-[(6-bromo-1,3-benzodioxol-5-yl)methyl]piperidin-1-yl]ethyl]-2-chlorobenzamide?
The InChIKey is FGDNVROSAQGSRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24BrClN2O3/c23-18-12-21-20(28-13-29-21)11-16(18)9-15-4-7-26(8-5-15)6-3-14-1-2-17(22(25)27)19(24)10-14/h1-2,10-12,15H,3-9,13H2,(H2,25,27).
What are the key properties of 4-[2-[4-[(6-bromo-1,3-benzodioxol-5-yl)methyl]piperidin-1-yl]ethyl]-2-chlorobenzamide?
4-[2-[4-[(6-bromo-1,3-benzodioxol-5-yl)methyl]piperidin-1-yl]ethyl]-2-chlorobenzamide has a molecular weight of 479.80 g/mol, XLogP of 4.43, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[4-[(6-bromo-1,3-benzodioxol-5-yl)methyl]piperidin-1-yl]ethyl]-2-chlorobenzamide is sourced from PubChem (CID 22675372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).