C27H25N3O2 — CID 22675624
1,2-bis(3-phenylmethoxyphenyl)guanidine (PubChem CID 22675624) has the molecular formula C27H25N3O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is 1,2-bis(3-phenylmethoxyphenyl)guanidine.
| Compound Name | 1,2-bis(3-phenylmethoxyphenyl)guanidine |
|---|---|
| PubChem CID | 22675624 |
| Molecular Formula | C27H25N3O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 1,2-bis(3-phenylmethoxyphenyl)guanidine |
| SMILES | N/C(=N\c1cccc(OCc2ccccc2)c1)Nc1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C27H25N3O2/c28-27(29-23-13-7-15-25(17-23)31-19-21-9-3-1-4-10-21)30-24-14-8-16-26(18-24)32-20-22-11-5-2-6-12-22/h1-18H,19-20H2,(H3,28,29,30) |
| InChIKey | DVEKLDWKSHFNHV-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|