About 1,2-bis(4-tert-butylphenyl)-1-methylguanidine;hydrobromide
1,2-bis(4-tert-butylphenyl)-1-methylguanidine;hydrobromide (PubChem CID 22675713) has the molecular formula C22H32BrN3
and a molecular weight of 418.42 g/mol. Its IUPAC name is 1,2-bis(4-tert-butylphenyl)-1-methylguanidine;hydrobromide.
Molecular Properties
| Compound Name | 1,2-bis(4-tert-butylphenyl)-1-methylguanidine;hydrobromide |
| PubChem CID | 22675713 |
| Molecular Formula | C22H32BrN3 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 1,2-bis(4-tert-butylphenyl)-1-methylguanidine;hydrobromide |
| SMILES | Br.CN(/C(N)=N/c1ccc(C(C)(C)C)cc1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H31N3.BrH/c1-21(2,3)16-8-12-18(13-9-16)24-20(23)25(7)19-14-10-17(11-15-19)22(4,5)6;/h8-15H,1-7H3,(H2,23,24);1H |
| InChIKey | QKMYYMNWVFVCHN-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1,2-bis(4-tert-butylphenyl)-1-methylguanidine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis(4-tert-butylphenyl)-1-methylguanidine;hydrobromide?
The IUPAC name of 1,2-bis(4-tert-butylphenyl)-1-methylguanidine;hydrobromide (CID 22675713) is 1,2-bis(4-tert-butylphenyl)-1-methylguanidine;hydrobromide.
What is the SMILES notation for 1,2-bis(4-tert-butylphenyl)-1-methylguanidine;hydrobromide?
The canonical SMILES for 1,2-bis(4-tert-butylphenyl)-1-methylguanidine;hydrobromide is Br.CN(/C(N)=N/c1ccc(C(C)(C)C)cc1)c1ccc(C(C)(C)C)cc1.
What is the InChIKey of 1,2-bis(4-tert-butylphenyl)-1-methylguanidine;hydrobromide?
The InChIKey is QKMYYMNWVFVCHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31N3.BrH/c1-21(2,3)16-8-12-18(13-9-16)24-20(23)25(7)19-14-10-17(11-15-19)22(4,5)6;/h8-15H,1-7H3,(H2,23,24);1H.
What are the key properties of 1,2-bis(4-tert-butylphenyl)-1-methylguanidine;hydrobromide?
1,2-bis(4-tert-butylphenyl)-1-methylguanidine;hydrobromide has a molecular weight of 418.42 g/mol, XLogP of 5.94, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(4-tert-butylphenyl)-1-methylguanidine;hydrobromide is sourced from PubChem (CID 22675713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).