C31H41ClN4 — CID 22675799
1-(4-butan-2-ylphenyl)-1-[(4-tert-butylphenyl)methyl]-2-(1,2,3,4-tetrahydroisoquinolin-1-yl)guanidine;hydrochloride (PubChem CID 22675799) has the molecular formula C31H41ClN4 and a molecular weight of 505.15 g/mol. Its IUPAC name is 1-(4-butan-2-ylphenyl)-1-[(4-tert-butylphenyl)methyl]-2-(1,2,3,4-tetrahydroisoquinolin-1-yl)guanidine;hydrochloride.
| Compound Name | 1-(4-butan-2-ylphenyl)-1-[(4-tert-butylphenyl)methyl]-2-(1,2,3,4-tetrahydroisoquinolin-1-yl)guanidine;hydrochloride |
|---|---|
| PubChem CID | 22675799 |
| Molecular Formula | C31H41ClN4 |
| Molecular Weight | 505.15 g/mol |
| Exact Mass | 504.30 |
| IUPAC Name | 1-(4-butan-2-ylphenyl)-1-[(4-tert-butylphenyl)methyl]-2-(1,2,3,4-tetrahydroisoquinolin-1-yl)guanidine;hydrochloride |
| SMILES | CCC(C)c1ccc(N(Cc2ccc(C(C)(C)C)cc2)/C(N)=N/C2NCCc3ccccc32)cc1.Cl |
| InChI | InChI=1S/C31H40N4.ClH/c1-6-22(2)24-13-17-27(18-14-24)35(21-23-11-15-26(16-12-23)31(3,4)5)30(32)34-29-28-10-8-7-9-25(28)19-20-33-29;/h7-18,22,29,33H,6,19-21H2,1-5H3,(H2,32,34);1H |
| InChIKey | QCHWCAGWRZMESO-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.15 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|