C33H29N3O2 — CID 22675851
1-phenyl-1,2-bis(4-phenylmethoxyphenyl)guanidine (PubChem CID 22675851) has the molecular formula C33H29N3O2 and a molecular weight of 499.61 g/mol. Its IUPAC name is 1-phenyl-1,2-bis(4-phenylmethoxyphenyl)guanidine.
| Compound Name | 1-phenyl-1,2-bis(4-phenylmethoxyphenyl)guanidine |
|---|---|
| PubChem CID | 22675851 |
| Molecular Formula | C33H29N3O2 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | 1-phenyl-1,2-bis(4-phenylmethoxyphenyl)guanidine |
| SMILES | N/C(=N\c1ccc(OCc2ccccc2)cc1)N(c1ccccc1)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C33H29N3O2/c34-33(35-28-16-20-31(21-17-28)37-24-26-10-4-1-5-11-26)36(29-14-8-3-9-15-29)30-18-22-32(23-19-30)38-25-27-12-6-2-7-13-27/h1-23H,24-25H2,(H2,34,35) |
| InChIKey | CWJSDMWAMWQHNY-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|