About Diethyl 2-benzoyl-3-phenylcyclopropane-1,1-dicarboxylate
Diethyl 2-benzoyl-3-phenylcyclopropane-1,1-dicarboxylate (PubChem CID 226759) has the molecular formula C22H22O5
and a molecular weight of 366.40 g/mol. Its IUPAC name is diethyl 2-benzoyl-3-phenylcyclopropane-1,1-dicarboxylate.
Molecular Properties
| Compound Name | Diethyl 2-benzoyl-3-phenylcyclopropane-1,1-dicarboxylate |
| PubChem CID | 226759 |
| Molecular Formula | C22H22O5 |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | diethyl 2-benzoyl-3-phenylcyclopropane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(C1C(=O)C2=CC=CC=C2)C3=CC=CC=C3)C(=O)OCC |
| InChI | InChI=1S/C22H22O5/c1-3-26-20(24)22(21(25)27-4-2)17(15-11-7-5-8-12-15)18(22)19(23)16-13-9-6-10-14-16/h5-14,17-18H,3-4H2,1-2H3 |
| InChIKey | PVRZLYTVZVHHPI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 69.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | 539 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze Diethyl 2-benzoyl-3-phenylcyclopropane-1,1-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Diethyl 2-benzoyl-3-phenylcyclopropane-1,1-dicarboxylate?
The IUPAC name of Diethyl 2-benzoyl-3-phenylcyclopropane-1,1-dicarboxylate (CID 226759) is diethyl 2-benzoyl-3-phenylcyclopropane-1,1-dicarboxylate.
What is the SMILES notation for Diethyl 2-benzoyl-3-phenylcyclopropane-1,1-dicarboxylate?
The canonical SMILES for Diethyl 2-benzoyl-3-phenylcyclopropane-1,1-dicarboxylate is CCOC(=O)C1(C(C1C(=O)C2=CC=CC=C2)C3=CC=CC=C3)C(=O)OCC.
What is the InChIKey of Diethyl 2-benzoyl-3-phenylcyclopropane-1,1-dicarboxylate?
The InChIKey is PVRZLYTVZVHHPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22O5/c1-3-26-20(24)22(21(25)27-4-2)17(15-11-7-5-8-12-15)18(22)19(23)16-13-9-6-10-14-16/h5-14,17-18H,3-4H2,1-2H3.
What are the key properties of Diethyl 2-benzoyl-3-phenylcyclopropane-1,1-dicarboxylate?
Diethyl 2-benzoyl-3-phenylcyclopropane-1,1-dicarboxylate has a molecular weight of 366.40 g/mol, XLogP of 3.60, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Diethyl 2-benzoyl-3-phenylcyclopropane-1,1-dicarboxylate is sourced from PubChem (CID 226759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).