About carbanide;2,3-dimethylcyclopenta-1,3-diene;zirconium(4+)
carbanide;2,3-dimethylcyclopenta-1,3-diene;zirconium(4+) (PubChem CID 22676373) has the molecular formula C10H18Zr
and a molecular weight of 229.48 g/mol. Its IUPAC name is carbanide;2,3-dimethylcyclopenta-1,3-diene;zirconium(4+).
Molecular Properties
| Compound Name | carbanide;2,3-dimethylcyclopenta-1,3-diene;zirconium(4+) |
| PubChem CID | 22676373 |
| Molecular Formula | C10H18Zr |
| Molecular Weight | 229.48 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | carbanide;2,3-dimethylcyclopenta-1,3-diene;zirconium(4+) |
| SMILES | CC1=[C-]CC=C1C.[CH3-].[CH3-].[CH3-].[Zr+4] |
| InChI | InChI=1S/C7H9.3CH3.Zr/c1-6-4-3-5-7(6)2;;;;/h4H,3H2,1-2H3;3*1H3;/q4*-1;+4 |
| InChIKey | NIUQSLMPVYFYOC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;2,3-dimethylcyclopenta-1,3-diene;zirconium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;2,3-dimethylcyclopenta-1,3-diene;zirconium(4+)?
The IUPAC name of carbanide;2,3-dimethylcyclopenta-1,3-diene;zirconium(4+) (CID 22676373) is carbanide;2,3-dimethylcyclopenta-1,3-diene;zirconium(4+).
What is the SMILES notation for carbanide;2,3-dimethylcyclopenta-1,3-diene;zirconium(4+)?
The canonical SMILES for carbanide;2,3-dimethylcyclopenta-1,3-diene;zirconium(4+) is CC1=[C-]CC=C1C.[CH3-].[CH3-].[CH3-].[Zr+4].
What is the InChIKey of carbanide;2,3-dimethylcyclopenta-1,3-diene;zirconium(4+)?
The InChIKey is NIUQSLMPVYFYOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9.3CH3.Zr/c1-6-4-3-5-7(6)2;;;;/h4H,3H2,1-2H3;3*1H3;/q4*-1;+4.
What are the key properties of carbanide;2,3-dimethylcyclopenta-1,3-diene;zirconium(4+)?
carbanide;2,3-dimethylcyclopenta-1,3-diene;zirconium(4+) has a molecular weight of 229.48 g/mol, XLogP of 3.43, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;2,3-dimethylcyclopenta-1,3-diene;zirconium(4+) is sourced from PubChem (CID 22676373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).