About spiro[adamantane-2,3'-oxetane]
spiro[adamantane-2,3'-oxetane] (PubChem CID 22677097) has the molecular formula C12H18O
and a molecular weight of 178.27 g/mol. Its IUPAC name is spiro[adamantane-2,3'-oxetane].
Molecular Properties
| Compound Name | spiro[adamantane-2,3'-oxetane] |
| PubChem CID | 22677097 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | spiro[adamantane-2,3'-oxetane] |
| SMILES | C1C2CC3CC1CC(C2)C31COC1 |
| InChI | InChI=1S/C12H18O/c1-8-2-10-4-9(1)5-11(3-8)12(10)6-13-7-12/h8-11H,1-7H2 |
| InChIKey | XJPCUZKIVUNKBP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze spiro[adamantane-2,3'-oxetane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[adamantane-2,3'-oxetane]?
The IUPAC name of spiro[adamantane-2,3'-oxetane] (CID 22677097) is spiro[adamantane-2,3'-oxetane].
What is the SMILES notation for spiro[adamantane-2,3'-oxetane]?
The canonical SMILES for spiro[adamantane-2,3'-oxetane] is C1C2CC3CC1CC(C2)C31COC1.
What is the InChIKey of spiro[adamantane-2,3'-oxetane]?
The InChIKey is XJPCUZKIVUNKBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O/c1-8-2-10-4-9(1)5-11(3-8)12(10)6-13-7-12/h8-11H,1-7H2.
What are the key properties of spiro[adamantane-2,3'-oxetane]?
spiro[adamantane-2,3'-oxetane] has a molecular weight of 178.27 g/mol, XLogP of 2.46, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[adamantane-2,3'-oxetane] is sourced from PubChem (CID 22677097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).