About [3-[(Z)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] naphthalene-2-sulfonate
[3-[(Z)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] naphthalene-2-sulfonate (PubChem CID 2267715) has the molecular formula C20H14N2O4S2
and a molecular weight of 410.48 g/mol. Its IUPAC name is [3-[(Z)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] naphthalene-2-sulfonate.
Molecular Properties
| Compound Name | [3-[(Z)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] naphthalene-2-sulfonate |
| PubChem CID | 2267715 |
| Molecular Formula | C20H14N2O4S2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | [3-[(Z)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] naphthalene-2-sulfonate |
| SMILES | NC1=NC(=O)/C(=C/c2cccc(OS(=O)(=O)c3ccc4ccccc4c3)c2)S1 |
| InChI | InChI=1S/C20H14N2O4S2/c21-20-22-19(23)18(27-20)11-13-4-3-7-16(10-13)26-28(24,25)17-9-8-14-5-1-2-6-15(14)12-17/h1-12H,(H2,21,22,23)/b18-11- |
| InChIKey | OHTQOYFOSDLEDB-WQRHYEAKSA-N |
| XLogP | 3.54 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [3-[(Z)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] naphthalene-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(Z)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] naphthalene-2-sulfonate?
The IUPAC name of [3-[(Z)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] naphthalene-2-sulfonate (CID 2267715) is [3-[(Z)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] naphthalene-2-sulfonate.
What is the SMILES notation for [3-[(Z)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] naphthalene-2-sulfonate?
The canonical SMILES for [3-[(Z)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] naphthalene-2-sulfonate is NC1=NC(=O)/C(=C/c2cccc(OS(=O)(=O)c3ccc4ccccc4c3)c2)S1.
What is the InChIKey of [3-[(Z)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] naphthalene-2-sulfonate?
The InChIKey is OHTQOYFOSDLEDB-WQRHYEAKSA-N. The full InChI is InChI=1S/C20H14N2O4S2/c21-20-22-19(23)18(27-20)11-13-4-3-7-16(10-13)26-28(24,25)17-9-8-14-5-1-2-6-15(14)12-17/h1-12H,(H2,21,22,23)/b18-11-.
What are the key properties of [3-[(Z)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] naphthalene-2-sulfonate?
[3-[(Z)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] naphthalene-2-sulfonate has a molecular weight of 410.48 g/mol, XLogP of 3.54, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(Z)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]phenyl] naphthalene-2-sulfonate is sourced from PubChem (CID 2267715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).