About methyl 4-amino-3,5-dichloro-6-(1,3-thiazol-5-yl)pyridine-2-carboxylate
methyl 4-amino-3,5-dichloro-6-(1,3-thiazol-5-yl)pyridine-2-carboxylate (PubChem CID 22677430) has the molecular formula C10H7Cl2N3O2S
and a molecular weight of 304.16 g/mol. Its IUPAC name is methyl 4-amino-3,5-dichloro-6-(1,3-thiazol-5-yl)pyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 4-amino-3,5-dichloro-6-(1,3-thiazol-5-yl)pyridine-2-carboxylate |
| PubChem CID | 22677430 |
| Molecular Formula | C10H7Cl2N3O2S |
| Molecular Weight | 304.16 g/mol |
| Exact Mass | 302.96 |
| IUPAC Name | methyl 4-amino-3,5-dichloro-6-(1,3-thiazol-5-yl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(-c2cncs2)c(Cl)c(N)c1Cl |
| InChI | InChI=1S/C10H7Cl2N3O2S/c1-17-10(16)9-6(12)7(13)5(11)8(15-9)4-2-14-3-18-4/h2-3H,1H3,(H2,13,15) |
| InChIKey | MVTAFOBJWUKVOK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.16 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4-amino-3,5-dichloro-6-(1,3-thiazol-5-yl)pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-amino-3,5-dichloro-6-(1,3-thiazol-5-yl)pyridine-2-carboxylate?
The IUPAC name of methyl 4-amino-3,5-dichloro-6-(1,3-thiazol-5-yl)pyridine-2-carboxylate (CID 22677430) is methyl 4-amino-3,5-dichloro-6-(1,3-thiazol-5-yl)pyridine-2-carboxylate.
What is the SMILES notation for methyl 4-amino-3,5-dichloro-6-(1,3-thiazol-5-yl)pyridine-2-carboxylate?
The canonical SMILES for methyl 4-amino-3,5-dichloro-6-(1,3-thiazol-5-yl)pyridine-2-carboxylate is COC(=O)c1nc(-c2cncs2)c(Cl)c(N)c1Cl.
What is the InChIKey of methyl 4-amino-3,5-dichloro-6-(1,3-thiazol-5-yl)pyridine-2-carboxylate?
The InChIKey is MVTAFOBJWUKVOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7Cl2N3O2S/c1-17-10(16)9-6(12)7(13)5(11)8(15-9)4-2-14-3-18-4/h2-3H,1H3,(H2,13,15).
What are the key properties of methyl 4-amino-3,5-dichloro-6-(1,3-thiazol-5-yl)pyridine-2-carboxylate?
methyl 4-amino-3,5-dichloro-6-(1,3-thiazol-5-yl)pyridine-2-carboxylate has a molecular weight of 304.16 g/mol, XLogP of 2.88, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-amino-3,5-dichloro-6-(1,3-thiazol-5-yl)pyridine-2-carboxylate is sourced from PubChem (CID 22677430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).