About methyl 4-amino-6-(1,3-benzodioxol-5-yl)-3,5-difluoropyridine-2-carboxylate
methyl 4-amino-6-(1,3-benzodioxol-5-yl)-3,5-difluoropyridine-2-carboxylate (PubChem CID 22677492) has the molecular formula C14H10F2N2O4
and a molecular weight of 308.24 g/mol. Its IUPAC name is methyl 4-amino-6-(1,3-benzodioxol-5-yl)-3,5-difluoropyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 4-amino-6-(1,3-benzodioxol-5-yl)-3,5-difluoropyridine-2-carboxylate |
| PubChem CID | 22677492 |
| Molecular Formula | C14H10F2N2O4 |
| Molecular Weight | 308.24 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | methyl 4-amino-6-(1,3-benzodioxol-5-yl)-3,5-difluoropyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(-c2ccc3c(c2)OCO3)c(F)c(N)c1F |
| InChI | InChI=1S/C14H10F2N2O4/c1-20-14(19)13-10(16)11(17)9(15)12(18-13)6-2-3-7-8(4-6)22-5-21-7/h2-4H,5H2,1H3,(H2,17,18) |
| InChIKey | QYLWQFDYMZHUOF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.24 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4-amino-6-(1,3-benzodioxol-5-yl)-3,5-difluoropyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-amino-6-(1,3-benzodioxol-5-yl)-3,5-difluoropyridine-2-carboxylate?
The IUPAC name of methyl 4-amino-6-(1,3-benzodioxol-5-yl)-3,5-difluoropyridine-2-carboxylate (CID 22677492) is methyl 4-amino-6-(1,3-benzodioxol-5-yl)-3,5-difluoropyridine-2-carboxylate.
What is the SMILES notation for methyl 4-amino-6-(1,3-benzodioxol-5-yl)-3,5-difluoropyridine-2-carboxylate?
The canonical SMILES for methyl 4-amino-6-(1,3-benzodioxol-5-yl)-3,5-difluoropyridine-2-carboxylate is COC(=O)c1nc(-c2ccc3c(c2)OCO3)c(F)c(N)c1F.
What is the InChIKey of methyl 4-amino-6-(1,3-benzodioxol-5-yl)-3,5-difluoropyridine-2-carboxylate?
The InChIKey is QYLWQFDYMZHUOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F2N2O4/c1-20-14(19)13-10(16)11(17)9(15)12(18-13)6-2-3-7-8(4-6)22-5-21-7/h2-4H,5H2,1H3,(H2,17,18).
What are the key properties of methyl 4-amino-6-(1,3-benzodioxol-5-yl)-3,5-difluoropyridine-2-carboxylate?
methyl 4-amino-6-(1,3-benzodioxol-5-yl)-3,5-difluoropyridine-2-carboxylate has a molecular weight of 308.24 g/mol, XLogP of 2.12, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-amino-6-(1,3-benzodioxol-5-yl)-3,5-difluoropyridine-2-carboxylate is sourced from PubChem (CID 22677492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).