C20H17FN2O4 — CID 22677811
methyl 1-(1,3-benzodioxol-5-yl)-6-fluoro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 22677811) has the molecular formula C20H17FN2O4 and a molecular weight of 368.36 g/mol. Its IUPAC name is methyl 1-(1,3-benzodioxol-5-yl)-6-fluoro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl 1-(1,3-benzodioxol-5-yl)-6-fluoro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 22677811 |
| Molecular Formula | C20H17FN2O4 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | methyl 1-(1,3-benzodioxol-5-yl)-6-fluoro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)C1Cc2c([nH]c3ccc(F)cc23)C(c2ccc3c(c2)OCO3)N1 |
| InChI | InChI=1S/C20H17FN2O4/c1-25-20(24)15-8-13-12-7-11(21)3-4-14(12)22-19(13)18(23-15)10-2-5-16-17(6-10)27-9-26-16/h2-7,15,18,22-23H,8-9H2,1H3 |
| InChIKey | ZLZCDKZCCDYRJF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|