About 2-[[4-[2-(1,3-benzodioxol-4-yl)ethyl]piperidin-1-yl]methyl]-6-bromopyridine
2-[[4-[2-(1,3-benzodioxol-4-yl)ethyl]piperidin-1-yl]methyl]-6-bromopyridine (PubChem CID 22678575) has the molecular formula C20H23BrN2O2
and a molecular weight of 403.32 g/mol. Its IUPAC name is 2-[[4-[2-(1,3-benzodioxol-4-yl)ethyl]piperidin-1-yl]methyl]-6-bromopyridine.
Molecular Properties
| Compound Name | 2-[[4-[2-(1,3-benzodioxol-4-yl)ethyl]piperidin-1-yl]methyl]-6-bromopyridine |
| PubChem CID | 22678575 |
| Molecular Formula | C20H23BrN2O2 |
| Molecular Weight | 403.32 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 2-[[4-[2-(1,3-benzodioxol-4-yl)ethyl]piperidin-1-yl]methyl]-6-bromopyridine |
| SMILES | Brc1cccc(CN2CCC(CCc3cccc4c3OCO4)CC2)n1 |
| InChI | InChI=1S/C20H23BrN2O2/c21-19-6-2-4-17(22-19)13-23-11-9-15(10-12-23)7-8-16-3-1-5-18-20(16)25-14-24-18/h1-6,15H,7-14H2 |
| InChIKey | WVUPPOJAUDOQLV-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.32 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-[[4-[2-(1,3-benzodioxol-4-yl)ethyl]piperidin-1-yl]methyl]-6-bromopyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-[2-(1,3-benzodioxol-4-yl)ethyl]piperidin-1-yl]methyl]-6-bromopyridine?
The IUPAC name of 2-[[4-[2-(1,3-benzodioxol-4-yl)ethyl]piperidin-1-yl]methyl]-6-bromopyridine (CID 22678575) is 2-[[4-[2-(1,3-benzodioxol-4-yl)ethyl]piperidin-1-yl]methyl]-6-bromopyridine.
What is the SMILES notation for 2-[[4-[2-(1,3-benzodioxol-4-yl)ethyl]piperidin-1-yl]methyl]-6-bromopyridine?
The canonical SMILES for 2-[[4-[2-(1,3-benzodioxol-4-yl)ethyl]piperidin-1-yl]methyl]-6-bromopyridine is Brc1cccc(CN2CCC(CCc3cccc4c3OCO4)CC2)n1.
What is the InChIKey of 2-[[4-[2-(1,3-benzodioxol-4-yl)ethyl]piperidin-1-yl]methyl]-6-bromopyridine?
The InChIKey is WVUPPOJAUDOQLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23BrN2O2/c21-19-6-2-4-17(22-19)13-23-11-9-15(10-12-23)7-8-16-3-1-5-18-20(16)25-14-24-18/h1-6,15H,7-14H2.
What are the key properties of 2-[[4-[2-(1,3-benzodioxol-4-yl)ethyl]piperidin-1-yl]methyl]-6-bromopyridine?
2-[[4-[2-(1,3-benzodioxol-4-yl)ethyl]piperidin-1-yl]methyl]-6-bromopyridine has a molecular weight of 403.32 g/mol, XLogP of 4.42, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-[2-(1,3-benzodioxol-4-yl)ethyl]piperidin-1-yl]methyl]-6-bromopyridine is sourced from PubChem (CID 22678575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).