About 3-butyl-3-ethyl-1,1-dioxo-5-phenylsulfanyl-4,5-dihydro-2H-1λ6-benzothiepin-4-ol
3-butyl-3-ethyl-1,1-dioxo-5-phenylsulfanyl-4,5-dihydro-2H-1λ6-benzothiepin-4-ol (PubChem CID 22678832) has the molecular formula C22H28O3S2
and a molecular weight of 404.60 g/mol. Its IUPAC name is 3-butyl-3-ethyl-1,1-dioxo-5-phenylsulfanyl-4,5-dihydro-2H-1λ6-benzothiepin-4-ol.
Molecular Properties
| Compound Name | 3-butyl-3-ethyl-1,1-dioxo-5-phenylsulfanyl-4,5-dihydro-2H-1λ6-benzothiepin-4-ol |
| PubChem CID | 22678832 |
| Molecular Formula | C22H28O3S2 |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 3-butyl-3-ethyl-1,1-dioxo-5-phenylsulfanyl-4,5-dihydro-2H-1λ6-benzothiepin-4-ol |
| SMILES | CCCCC1(CC)CS(=O)(=O)c2ccccc2C(Sc2ccccc2)C1O |
| InChI | InChI=1S/C22H28O3S2/c1-3-5-15-22(4-2)16-27(24,25)19-14-10-9-13-18(19)20(21(22)23)26-17-11-7-6-8-12-17/h6-14,20-21,23H,3-5,15-16H2,1-2H3 |
| InChIKey | GBRMONFVJCKEEJ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-butyl-3-ethyl-1,1-dioxo-5-phenylsulfanyl-4,5-dihydro-2H-1λ6-benzothiepin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-3-ethyl-1,1-dioxo-5-phenylsulfanyl-4,5-dihydro-2H-1λ6-benzothiepin-4-ol?
The IUPAC name of 3-butyl-3-ethyl-1,1-dioxo-5-phenylsulfanyl-4,5-dihydro-2H-1λ6-benzothiepin-4-ol (CID 22678832) is 3-butyl-3-ethyl-1,1-dioxo-5-phenylsulfanyl-4,5-dihydro-2H-1λ6-benzothiepin-4-ol.
What is the SMILES notation for 3-butyl-3-ethyl-1,1-dioxo-5-phenylsulfanyl-4,5-dihydro-2H-1λ6-benzothiepin-4-ol?
The canonical SMILES for 3-butyl-3-ethyl-1,1-dioxo-5-phenylsulfanyl-4,5-dihydro-2H-1λ6-benzothiepin-4-ol is CCCCC1(CC)CS(=O)(=O)c2ccccc2C(Sc2ccccc2)C1O.
What is the InChIKey of 3-butyl-3-ethyl-1,1-dioxo-5-phenylsulfanyl-4,5-dihydro-2H-1λ6-benzothiepin-4-ol?
The InChIKey is GBRMONFVJCKEEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28O3S2/c1-3-5-15-22(4-2)16-27(24,25)19-14-10-9-13-18(19)20(21(22)23)26-17-11-7-6-8-12-17/h6-14,20-21,23H,3-5,15-16H2,1-2H3.
What are the key properties of 3-butyl-3-ethyl-1,1-dioxo-5-phenylsulfanyl-4,5-dihydro-2H-1λ6-benzothiepin-4-ol?
3-butyl-3-ethyl-1,1-dioxo-5-phenylsulfanyl-4,5-dihydro-2H-1λ6-benzothiepin-4-ol has a molecular weight of 404.60 g/mol, XLogP of 5.25, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-3-ethyl-1,1-dioxo-5-phenylsulfanyl-4,5-dihydro-2H-1λ6-benzothiepin-4-ol is sourced from PubChem (CID 22678832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).