C23H27NO5 — CID 22681640
1-[2-[4-[2-(2,6-dimethylphenoxy)ethoxy]phenyl]ethyl]-5-oxopyrrolidine-3-carboxylic acid (PubChem CID 22681640) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is 1-[2-[4-[2-(2,6-dimethylphenoxy)ethoxy]phenyl]ethyl]-5-oxopyrrolidine-3-carboxylic acid.
| Compound Name | 1-[2-[4-[2-(2,6-dimethylphenoxy)ethoxy]phenyl]ethyl]-5-oxopyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 22681640 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 1-[2-[4-[2-(2,6-dimethylphenoxy)ethoxy]phenyl]ethyl]-5-oxopyrrolidine-3-carboxylic acid |
| SMILES | Cc1cccc(C)c1OCCOc1ccc(CCN2CC(C(=O)O)CC2=O)cc1 |
| InChI | InChI=1S/C23H27NO5/c1-16-4-3-5-17(2)22(16)29-13-12-28-20-8-6-18(7-9-20)10-11-24-15-19(23(26)27)14-21(24)25/h3-9,19H,10-15H2,1-2H3,(H,26,27) |
| InChIKey | UWCUNGHIHSMWOF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|