C22H23NO4S — CID 22681892
4-methyl-2-[2-[2-(2,3,6-trimethylphenoxy)ethoxy]phenyl]-1,3-thiazole-5-carboxylic acid (PubChem CID 22681892) has the molecular formula C22H23NO4S and a molecular weight of 397.50 g/mol. Its IUPAC name is 4-methyl-2-[2-[2-(2,3,6-trimethylphenoxy)ethoxy]phenyl]-1,3-thiazole-5-carboxylic acid.
| Compound Name | 4-methyl-2-[2-[2-(2,3,6-trimethylphenoxy)ethoxy]phenyl]-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 22681892 |
| Molecular Formula | C22H23NO4S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 4-methyl-2-[2-[2-(2,3,6-trimethylphenoxy)ethoxy]phenyl]-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1ccc(C)c(OCCOc2ccccc2-c2nc(C)c(C(=O)O)s2)c1C |
| InChI | InChI=1S/C22H23NO4S/c1-13-9-10-14(2)19(15(13)3)27-12-11-26-18-8-6-5-7-17(18)21-23-16(4)20(28-21)22(24)25/h5-10H,11-12H2,1-4H3,(H,24,25) |
| InChIKey | CAIRQMBXBWMCDN-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|