C20H21FN2O4 — CID 22682363
2-cyano-N-[2-[2-[2-(4-fluorophenoxy)ethoxy]-4-methoxyphenyl]ethyl]acetamide (PubChem CID 22682363) has the molecular formula C20H21FN2O4 and a molecular weight of 372.40 g/mol. Its IUPAC name is 2-cyano-N-[2-[2-[2-(4-fluorophenoxy)ethoxy]-4-methoxyphenyl]ethyl]acetamide.
| Compound Name | 2-cyano-N-[2-[2-[2-(4-fluorophenoxy)ethoxy]-4-methoxyphenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 22682363 |
| Molecular Formula | C20H21FN2O4 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 2-cyano-N-[2-[2-[2-(4-fluorophenoxy)ethoxy]-4-methoxyphenyl]ethyl]acetamide |
| SMILES | COc1ccc(CCNC(=O)CC#N)c(OCCOc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C20H21FN2O4/c1-25-18-5-2-15(9-11-23-20(24)8-10-22)19(14-18)27-13-12-26-17-6-3-16(21)4-7-17/h2-7,14H,8-9,11-13H2,1H3,(H,23,24) |
| InChIKey | TZAAPBIPHFACGU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|