C22H19N3O5S3 — CID 2268273
N-(1,3-benzothiazol-2-yl)-2-[(5E)-4-oxo-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]acetamide (PubChem CID 2268273) has the molecular formula C22H19N3O5S3 and a molecular weight of 501.61 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-[(5E)-4-oxo-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-[(5E)-4-oxo-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 2268273 |
| Molecular Formula | C22H19N3O5S3 |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.05 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-[(5E)-4-oxo-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]acetamide |
| SMILES | COc1cc(/C=C2/SC(=S)N(CC(=O)Nc3nc4ccccc4s3)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C22H19N3O5S3/c1-28-14-8-12(9-15(29-2)19(14)30-3)10-17-20(27)25(22(31)33-17)11-18(26)24-21-23-13-6-4-5-7-16(13)32-21/h4-10H,11H2,1-3H3,(H,23,24,26)/b17-10+ |
| InChIKey | XRXJJQVVKJZHGL-LICLKQGHSA-N |
| XLogP | 4.16 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|