About 2-[4-[3-(dimethylamino)propoxy]phenyl]-4-methyl-1,3-thiazole-5-sulfonyl chloride
2-[4-[3-(dimethylamino)propoxy]phenyl]-4-methyl-1,3-thiazole-5-sulfonyl chloride (PubChem CID 22683688) has the molecular formula C15H19ClN2O3S2
and a molecular weight of 374.92 g/mol. Its IUPAC name is 2-[4-[3-(dimethylamino)propoxy]phenyl]-4-methyl-1,3-thiazole-5-sulfonyl chloride.
Molecular Properties
| Compound Name | 2-[4-[3-(dimethylamino)propoxy]phenyl]-4-methyl-1,3-thiazole-5-sulfonyl chloride |
| PubChem CID | 22683688 |
| Molecular Formula | C15H19ClN2O3S2 |
| Molecular Weight | 374.92 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 2-[4-[3-(dimethylamino)propoxy]phenyl]-4-methyl-1,3-thiazole-5-sulfonyl chloride |
| SMILES | Cc1nc(-c2ccc(OCCCN(C)C)cc2)sc1S(=O)(=O)Cl |
| InChI | InChI=1S/C15H19ClN2O3S2/c1-11-15(23(16,19)20)22-14(17-11)12-5-7-13(8-6-12)21-10-4-9-18(2)3/h5-8H,4,9-10H2,1-3H3 |
| InChIKey | LCNDNHYYGMPYER-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.92 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[3-(dimethylamino)propoxy]phenyl]-4-methyl-1,3-thiazole-5-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[3-(dimethylamino)propoxy]phenyl]-4-methyl-1,3-thiazole-5-sulfonyl chloride?
The IUPAC name of 2-[4-[3-(dimethylamino)propoxy]phenyl]-4-methyl-1,3-thiazole-5-sulfonyl chloride (CID 22683688) is 2-[4-[3-(dimethylamino)propoxy]phenyl]-4-methyl-1,3-thiazole-5-sulfonyl chloride.
What is the SMILES notation for 2-[4-[3-(dimethylamino)propoxy]phenyl]-4-methyl-1,3-thiazole-5-sulfonyl chloride?
The canonical SMILES for 2-[4-[3-(dimethylamino)propoxy]phenyl]-4-methyl-1,3-thiazole-5-sulfonyl chloride is Cc1nc(-c2ccc(OCCCN(C)C)cc2)sc1S(=O)(=O)Cl.
What is the InChIKey of 2-[4-[3-(dimethylamino)propoxy]phenyl]-4-methyl-1,3-thiazole-5-sulfonyl chloride?
The InChIKey is LCNDNHYYGMPYER-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19ClN2O3S2/c1-11-15(23(16,19)20)22-14(17-11)12-5-7-13(8-6-12)21-10-4-9-18(2)3/h5-8H,4,9-10H2,1-3H3.
What are the key properties of 2-[4-[3-(dimethylamino)propoxy]phenyl]-4-methyl-1,3-thiazole-5-sulfonyl chloride?
2-[4-[3-(dimethylamino)propoxy]phenyl]-4-methyl-1,3-thiazole-5-sulfonyl chloride has a molecular weight of 374.92 g/mol, XLogP of 3.38, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[3-(dimethylamino)propoxy]phenyl]-4-methyl-1,3-thiazole-5-sulfonyl chloride is sourced from PubChem (CID 22683688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).