C20H25NO2S — CID 22683901
3-[2-(2-tert-butyl-5-methylphenoxy)ethoxy]benzenecarbothioamide (PubChem CID 22683901) has the molecular formula C20H25NO2S and a molecular weight of 343.49 g/mol. Its IUPAC name is 3-[2-(2-tert-butyl-5-methylphenoxy)ethoxy]benzenecarbothioamide.
| Compound Name | 3-[2-(2-tert-butyl-5-methylphenoxy)ethoxy]benzenecarbothioamide |
|---|---|
| PubChem CID | 22683901 |
| Molecular Formula | C20H25NO2S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 3-[2-(2-tert-butyl-5-methylphenoxy)ethoxy]benzenecarbothioamide |
| SMILES | Cc1ccc(C(C)(C)C)c(OCCOc2cccc(C(N)=S)c2)c1 |
| InChI | InChI=1S/C20H25NO2S/c1-14-8-9-17(20(2,3)4)18(12-14)23-11-10-22-16-7-5-6-15(13-16)19(21)24/h5-9,12-13H,10-11H2,1-4H3,(H2,21,24) |
| InChIKey | LLRRTGGSOXCMGM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|