C13H22N2O — CID 22683982
3-[2-(2-aminoethyl)phenoxy]-N,N-dimethylpropan-1-amine (PubChem CID 22683982) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 3-[2-(2-aminoethyl)phenoxy]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[2-(2-aminoethyl)phenoxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 22683982 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 3-[2-(2-aminoethyl)phenoxy]-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCOc1ccccc1CCN |
| InChI | InChI=1S/C13H22N2O/c1-15(2)10-5-11-16-13-7-4-3-6-12(13)8-9-14/h3-4,6-7H,5,8-11,14H2,1-2H3 |
| InChIKey | YKLHUWMQSJSGLY-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|