5-[1-(2,5-dichlorophenyl)sulfanylethyl]furan-2-carboxylic acid

C13H10Cl2O3S — CID 22685286

IUPAC5-[1-(2,5-dichlorophenyl)sulfanylethyl]furan-2-carboxylic acid
SMILESCC(Sc1cc(Cl)ccc1Cl)c1ccc(C(=O)O)o1
InChIInChI=1S/C13H10Cl2O3S/c1-7(10-4-5-11(18-10)13(16)17)19-12-6-8(14)2-3-9(12)15/h2-7H,1H3,(H,16,17)
InChIKeyWUXWUHVGVOQXTE-UHFFFAOYSA-N
MW317.19 g/mol
LogP5.14
Rot. Bonds4

About 5-[1-(2,5-dichlorophenyl)sulfanylethyl]furan-2-carboxylic acid

5-[1-(2,5-dichlorophenyl)sulfanylethyl]furan-2-carboxylic acid (PubChem CID 22685286) has the molecular formula C13H10Cl2O3S and a molecular weight of 317.19 g/mol. Its IUPAC name is 5-[1-(2,5-dichlorophenyl)sulfanylethyl]furan-2-carboxylic acid.

Molecular Properties

Compound Name5-[1-(2,5-dichlorophenyl)sulfanylethyl]furan-2-carboxylic acid
PubChem CID22685286
Molecular FormulaC13H10Cl2O3S
Molecular Weight317.19 g/mol
Exact Mass315.97
IUPAC Name5-[1-(2,5-dichlorophenyl)sulfanylethyl]furan-2-carboxylic acid
SMILESCC(Sc1cc(Cl)ccc1Cl)c1ccc(C(=O)O)o1
InChIInChI=1S/C13H10Cl2O3S/c1-7(10-4-5-11(18-10)13(16)17)19-12-6-8(14)2-3-9(12)15/h2-7H,1H3,(H,16,17)
InChIKeyWUXWUHVGVOQXTE-UHFFFAOYSA-N
XLogP5.14
TPSA50.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500317.19
LogP ≤ 55.14
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-[1-(2,5-dichlorophenyl)sulfanylethyl]furan-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[1-(2,5-dichlorophenyl)sulfanylethyl]furan-2-carboxylic acid?
The IUPAC name of 5-[1-(2,5-dichlorophenyl)sulfanylethyl]furan-2-carboxylic acid (CID 22685286) is 5-[1-(2,5-dichlorophenyl)sulfanylethyl]furan-2-carboxylic acid.
What is the SMILES notation for 5-[1-(2,5-dichlorophenyl)sulfanylethyl]furan-2-carboxylic acid?
The canonical SMILES for 5-[1-(2,5-dichlorophenyl)sulfanylethyl]furan-2-carboxylic acid is CC(Sc1cc(Cl)ccc1Cl)c1ccc(C(=O)O)o1.
What is the InChIKey of 5-[1-(2,5-dichlorophenyl)sulfanylethyl]furan-2-carboxylic acid?
The InChIKey is WUXWUHVGVOQXTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10Cl2O3S/c1-7(10-4-5-11(18-10)13(16)17)19-12-6-8(14)2-3-9(12)15/h2-7H,1H3,(H,16,17).
What are the key properties of 5-[1-(2,5-dichlorophenyl)sulfanylethyl]furan-2-carboxylic acid?
5-[1-(2,5-dichlorophenyl)sulfanylethyl]furan-2-carboxylic acid has a molecular weight of 317.19 g/mol, XLogP of 5.14, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(2,5-dichlorophenyl)sulfanylethyl]furan-2-carboxylic acid is sourced from PubChem (CID 22685286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).