About N,N-dipropylformamide
N,N-dipropylformamide (PubChem CID 22687) has the molecular formula C7H15NO
and a molecular weight of 129.20 g/mol. Its IUPAC name is N,N-dipropylformamide.
Molecular Properties
| Compound Name | N,N-dipropylformamide |
| PubChem CID | 22687 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | N,N-dipropylformamide |
| SMILES | CCCN(C=O)CCC |
| InChI | InChI=1S/C7H15NO/c1-3-5-8(7-9)6-4-2/h7H,3-6H2,1-2H3 |
| InChIKey | XFTIKWYXFSNCQF-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N,N-dipropylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dipropylformamide?
The IUPAC name of N,N-dipropylformamide (CID 22687) is N,N-dipropylformamide.
What is the SMILES notation for N,N-dipropylformamide?
The canonical SMILES for N,N-dipropylformamide is CCCN(C=O)CCC.
What is the InChIKey of N,N-dipropylformamide?
The InChIKey is XFTIKWYXFSNCQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO/c1-3-5-8(7-9)6-4-2/h7H,3-6H2,1-2H3.
What are the key properties of N,N-dipropylformamide?
N,N-dipropylformamide has a molecular weight of 129.20 g/mol, XLogP of 1.26, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dipropylformamide is sourced from PubChem (CID 22687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).