C16H20ClNO4S2 — CID 22687029
2-(4-methoxy-2-pentoxyphenyl)-4-methyl-1,3-thiazole-5-sulfonyl chloride (PubChem CID 22687029) has the molecular formula C16H20ClNO4S2 and a molecular weight of 389.93 g/mol. Its IUPAC name is 2-(4-methoxy-2-pentoxyphenyl)-4-methyl-1,3-thiazole-5-sulfonyl chloride.
| Compound Name | 2-(4-methoxy-2-pentoxyphenyl)-4-methyl-1,3-thiazole-5-sulfonyl chloride |
|---|---|
| PubChem CID | 22687029 |
| Molecular Formula | C16H20ClNO4S2 |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | 2-(4-methoxy-2-pentoxyphenyl)-4-methyl-1,3-thiazole-5-sulfonyl chloride |
| SMILES | CCCCCOc1cc(OC)ccc1-c1nc(C)c(S(=O)(=O)Cl)s1 |
| InChI | InChI=1S/C16H20ClNO4S2/c1-4-5-6-9-22-14-10-12(21-3)7-8-13(14)15-18-11(2)16(23-15)24(17,19)20/h7-8,10H,4-6,9H2,1-3H3 |
| InChIKey | ASTOUBRJFBIANA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|