2-[2-(1,3-benzoxazol-2-ylsulfanyl)ethylsulfanyl]benzoic acid

C16H13NO3S2 — CID 2268780

IUPAC2-[2-(1,3-benzoxazol-2-ylsulfanyl)ethylsulfanyl]benzoic acid
SMILESO=C(O)c1ccccc1SCCSc1nc2ccccc2o1
InChIInChI=1S/C16H13NO3S2/c18-15(19)11-5-1-4-8-14(11)21-9-10-22-16-17-12-6-2-3-7-13(12)20-16/h1-8H,9-10H2,(H,18,19)
InChIKeyGUHOWGXJSXQZBU-UHFFFAOYSA-N
MW331.42 g/mol
LogP4.41
Rot. Bonds6

About 2-[2-(1,3-benzoxazol-2-ylsulfanyl)ethylsulfanyl]benzoic acid

2-[2-(1,3-benzoxazol-2-ylsulfanyl)ethylsulfanyl]benzoic acid (PubChem CID 2268780) has the molecular formula C16H13NO3S2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 2-[2-(1,3-benzoxazol-2-ylsulfanyl)ethylsulfanyl]benzoic acid.

Molecular Properties

Compound Name2-[2-(1,3-benzoxazol-2-ylsulfanyl)ethylsulfanyl]benzoic acid
PubChem CID2268780
Molecular FormulaC16H13NO3S2
Molecular Weight331.42 g/mol
Exact Mass331.03
IUPAC Name2-[2-(1,3-benzoxazol-2-ylsulfanyl)ethylsulfanyl]benzoic acid
SMILESO=C(O)c1ccccc1SCCSc1nc2ccccc2o1
InChIInChI=1S/C16H13NO3S2/c18-15(19)11-5-1-4-8-14(11)21-9-10-22-16-17-12-6-2-3-7-13(12)20-16/h1-8H,9-10H2,(H,18,19)
InChIKeyGUHOWGXJSXQZBU-UHFFFAOYSA-N
XLogP4.41
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500331.42
LogP ≤ 54.41
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-[2-(1,3-benzoxazol-2-ylsulfanyl)ethylsulfanyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(1,3-benzoxazol-2-ylsulfanyl)ethylsulfanyl]benzoic acid?
The IUPAC name of 2-[2-(1,3-benzoxazol-2-ylsulfanyl)ethylsulfanyl]benzoic acid (CID 2268780) is 2-[2-(1,3-benzoxazol-2-ylsulfanyl)ethylsulfanyl]benzoic acid.
What is the SMILES notation for 2-[2-(1,3-benzoxazol-2-ylsulfanyl)ethylsulfanyl]benzoic acid?
The canonical SMILES for 2-[2-(1,3-benzoxazol-2-ylsulfanyl)ethylsulfanyl]benzoic acid is O=C(O)c1ccccc1SCCSc1nc2ccccc2o1.
What is the InChIKey of 2-[2-(1,3-benzoxazol-2-ylsulfanyl)ethylsulfanyl]benzoic acid?
The InChIKey is GUHOWGXJSXQZBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO3S2/c18-15(19)11-5-1-4-8-14(11)21-9-10-22-16-17-12-6-2-3-7-13(12)20-16/h1-8H,9-10H2,(H,18,19).
What are the key properties of 2-[2-(1,3-benzoxazol-2-ylsulfanyl)ethylsulfanyl]benzoic acid?
2-[2-(1,3-benzoxazol-2-ylsulfanyl)ethylsulfanyl]benzoic acid has a molecular weight of 331.42 g/mol, XLogP of 4.41, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1,3-benzoxazol-2-ylsulfanyl)ethylsulfanyl]benzoic acid is sourced from PubChem (CID 2268780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).