About (5S)-5-butan-2-yl-3,3-diethylmorpholin-2-one
(5S)-5-butan-2-yl-3,3-diethylmorpholin-2-one (PubChem CID 22689073) has the molecular formula C12H23NO2
and a molecular weight of 213.32 g/mol. Its IUPAC name is (5S)-5-butan-2-yl-3,3-diethylmorpholin-2-one.
Molecular Properties
| Compound Name | (5S)-5-butan-2-yl-3,3-diethylmorpholin-2-one |
| PubChem CID | 22689073 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | (5S)-5-butan-2-yl-3,3-diethylmorpholin-2-one |
| SMILES | CCC(C)[C@H]1COC(=O)C(CC)(CC)N1 |
| InChI | InChI=1S/C12H23NO2/c1-5-9(4)10-8-15-11(14)12(6-2,7-3)13-10/h9-10,13H,5-8H2,1-4H3/t9?,10-/m1/s1 |
| InChIKey | MPDPLTNSYMKRGJ-QVDQXJPCSA-N |
| XLogP | 2.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5S)-5-butan-2-yl-3,3-diethylmorpholin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-butan-2-yl-3,3-diethylmorpholin-2-one?
The IUPAC name of (5S)-5-butan-2-yl-3,3-diethylmorpholin-2-one (CID 22689073) is (5S)-5-butan-2-yl-3,3-diethylmorpholin-2-one.
What is the SMILES notation for (5S)-5-butan-2-yl-3,3-diethylmorpholin-2-one?
The canonical SMILES for (5S)-5-butan-2-yl-3,3-diethylmorpholin-2-one is CCC(C)[C@H]1COC(=O)C(CC)(CC)N1.
What is the InChIKey of (5S)-5-butan-2-yl-3,3-diethylmorpholin-2-one?
The InChIKey is MPDPLTNSYMKRGJ-QVDQXJPCSA-N. The full InChI is InChI=1S/C12H23NO2/c1-5-9(4)10-8-15-11(14)12(6-2,7-3)13-10/h9-10,13H,5-8H2,1-4H3/t9?,10-/m1/s1.
What are the key properties of (5S)-5-butan-2-yl-3,3-diethylmorpholin-2-one?
(5S)-5-butan-2-yl-3,3-diethylmorpholin-2-one has a molecular weight of 213.32 g/mol, XLogP of 2.11, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-butan-2-yl-3,3-diethylmorpholin-2-one is sourced from PubChem (CID 22689073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).