C19H33N3 — CID 22689518
(2S)-3-methyl-1-[4-(3-phenylpropyl)piperazin-1-yl]pentan-2-amine (PubChem CID 22689518) has the molecular formula C19H33N3 and a molecular weight of 303.49 g/mol. Its IUPAC name is (2S)-3-methyl-1-[4-(3-phenylpropyl)piperazin-1-yl]pentan-2-amine.
| Compound Name | (2S)-3-methyl-1-[4-(3-phenylpropyl)piperazin-1-yl]pentan-2-amine |
|---|---|
| PubChem CID | 22689518 |
| Molecular Formula | C19H33N3 |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.27 |
| IUPAC Name | (2S)-3-methyl-1-[4-(3-phenylpropyl)piperazin-1-yl]pentan-2-amine |
| SMILES | CCC(C)[C@H](N)CN1CCN(CCCc2ccccc2)CC1 |
| InChI | InChI=1S/C19H33N3/c1-3-17(2)19(20)16-22-14-12-21(13-15-22)11-7-10-18-8-5-4-6-9-18/h4-6,8-9,17,19H,3,7,10-16,20H2,1-2H3/t17?,19-/m1/s1 |
| InChIKey | XEFKROPEXRNLDO-WHCXFUJUSA-N |
| XLogP | 2.61 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |