C15H20N2O3S — CID 22690179
(4aS,7aR)-3,3-dimethyl-1-(3-methylphenyl)-6,6-dioxo-4a,5,7,7a-tetrahydro-4H-thieno[3,4-b]pyrazin-2-one (PubChem CID 22690179) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is (4aS,7aR)-3,3-dimethyl-1-(3-methylphenyl)-6,6-dioxo-4a,5,7,7a-tetrahydro-4H-thieno[3,4-b]pyrazin-2-one.
| Compound Name | (4aS,7aR)-3,3-dimethyl-1-(3-methylphenyl)-6,6-dioxo-4a,5,7,7a-tetrahydro-4H-thieno[3,4-b]pyrazin-2-one |
|---|---|
| PubChem CID | 22690179 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | (4aS,7aR)-3,3-dimethyl-1-(3-methylphenyl)-6,6-dioxo-4a,5,7,7a-tetrahydro-4H-thieno[3,4-b]pyrazin-2-one |
| SMILES | Cc1cccc(N2C(=O)C(C)(C)N[C@@H]3CS(=O)(=O)C[C@@H]32)c1 |
| InChI | InChI=1S/C15H20N2O3S/c1-10-5-4-6-11(7-10)17-13-9-21(19,20)8-12(13)16-15(2,3)14(17)18/h4-7,12-13,16H,8-9H2,1-3H3/t12-,13+/m1/s1 |
| InChIKey | ILQZYJLZTHETBI-OLZOCXBDSA-N |
| XLogP | 0.88 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |