C17H24N2O4S — CID 22690235
(2S,4aR,7aS)-2-butan-2-yl-4-(3-methoxyphenyl)-6,6-dioxo-1,2,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-3-one (PubChem CID 22690235) has the molecular formula C17H24N2O4S and a molecular weight of 352.46 g/mol. Its IUPAC name is (2S,4aR,7aS)-2-butan-2-yl-4-(3-methoxyphenyl)-6,6-dioxo-1,2,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-3-one.
| Compound Name | (2S,4aR,7aS)-2-butan-2-yl-4-(3-methoxyphenyl)-6,6-dioxo-1,2,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-3-one |
|---|---|
| PubChem CID | 22690235 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | (2S,4aR,7aS)-2-butan-2-yl-4-(3-methoxyphenyl)-6,6-dioxo-1,2,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-3-one |
| SMILES | CCC(C)[C@@H]1N[C@@H]2CS(=O)(=O)C[C@@H]2N(c2cccc(OC)c2)C1=O |
| InChI | InChI=1S/C17H24N2O4S/c1-4-11(2)16-17(20)19(12-6-5-7-13(8-12)23-3)15-10-24(21,22)9-14(15)18-16/h5-8,11,14-16,18H,4,9-10H2,1-3H3/t11?,14-,15+,16+/m1/s1 |
| InChIKey | QEPFNBHCELTNGO-JATSYGIVSA-N |
| XLogP | 1.21 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |